C28H18O8 — CID 75178413
3,11-bis(3,4-dihydroxyphenyl)-4,12-dioxapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1,5,7,9(18),10(17),13,15-heptaene-7,15-diol (PubChem CID 75178413) has the molecular formula C28H18O8 and a molecular weight of 482.44 g/mol. Its IUPAC name is 3,11-bis(3,4-dihydroxyphenyl)-4,12-dioxapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1,5,7,9(18),10(17),13,15-heptaene-7,15-diol.
| Compound Name | 3,11-bis(3,4-dihydroxyphenyl)-4,12-dioxapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1,5,7,9(18),10(17),13,15-heptaene-7,15-diol |
|---|---|
| PubChem CID | 75178413 |
| Molecular Formula | C28H18O8 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 3,11-bis(3,4-dihydroxyphenyl)-4,12-dioxapentacyclo[8.6.1.12,5.013,17.09,18]octadeca-1,5,7,9(18),10(17),13,15-heptaene-7,15-diol |
| SMILES | Oc1cc2c3c(c4cc(O)cc5c4c(c3c1)C(c1ccc(O)c(O)c1)O5)C(c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C28H18O8/c29-13-7-15-24-22(10-13)36-28(12-2-4-18(32)20(34)6-12)26(24)16-8-14(30)9-21-23(16)25(15)27(35-21)11-1-3-17(31)19(33)5-11/h1-10,27-34H |
| InChIKey | GALBTJBRHHLUOS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|