C15H14O6 — CID 118886882
(3R)-2,4-dideuterio-2-(3,4-dihydroxyphenyl)-3,4-dihydrochromene-3,5,7-triol (PubChem CID 118886882) has the molecular formula C15H14O6 and a molecular weight of 292.28 g/mol. Its IUPAC name is (3R)-2,4-dideuterio-2-(3,4-dihydroxyphenyl)-3,4-dihydrochromene-3,5,7-triol.
| Compound Name | (3R)-2,4-dideuterio-2-(3,4-dihydroxyphenyl)-3,4-dihydrochromene-3,5,7-triol |
|---|---|
| PubChem CID | 118886882 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (3R)-2,4-dideuterio-2-(3,4-dihydroxyphenyl)-3,4-dihydrochromene-3,5,7-triol |
| SMILES | [2H]C1c2c(O)cc(O)cc2OC([2H])(c2ccc(O)c(O)c2)[C@@H]1O |
| InChI | InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15?/m1/s1/i6D,15D/t6?,13-,15? |
| InChIKey | PFTAWBLQPZVEMU-KIGRTNNOSA-N |
| XLogP | 1.55 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|