C16H16O5 — CID 162862077
(6S,7R)-6-(3,4-dihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol (PubChem CID 162862077) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (6S,7R)-6-(3,4-dihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol.
| Compound Name | (6S,7R)-6-(3,4-dihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol |
|---|---|
| PubChem CID | 162862077 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (6S,7R)-6-(3,4-dihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol |
| SMILES | Oc1cc(O)c2c(c1)C[C@@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C16H16O5/c17-10-3-9-4-11(8-1-2-13(18)16(21)5-8)15(20)7-12(9)14(19)6-10/h1-3,5-6,11,15,17-21H,4,7H2/t11-,15+/m0/s1 |
| InChIKey | IUIXNLXBIRTHMO-XHDPSFHLSA-N |
| XLogP | 1.75 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|