C27H28O9 — CID 164619023
[(2R,3R)-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl] (3S)-5-(3,4-dihydroxyphenyl)-3-hydroxypentanoate (PubChem CID 164619023) has the molecular formula C27H28O9 and a molecular weight of 496.51 g/mol. Its IUPAC name is [(2R,3R)-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl] (3S)-5-(3,4-dihydroxyphenyl)-3-hydroxypentanoate.
| Compound Name | [(2R,3R)-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl] (3S)-5-(3,4-dihydroxyphenyl)-3-hydroxypentanoate |
|---|---|
| PubChem CID | 164619023 |
| Molecular Formula | C27H28O9 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [(2R,3R)-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl] (3S)-5-(3,4-dihydroxyphenyl)-3-hydroxypentanoate |
| SMILES | O=C(C[C@@H](O)CCc1ccc(O)c(O)c1)O[C@@H]1Cc2c(O)cc(O)cc2C[C@@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C27H28O9/c28-17(4-1-14-2-5-21(30)24(33)7-14)12-27(35)36-26-13-19-16(8-18(29)11-23(19)32)9-20(26)15-3-6-22(31)25(34)10-15/h2-3,5-8,10-11,17,20,26,28-34H,1,4,9,12-13H2/t17-,20+,26+/m0/s1 |
| InChIKey | YLXFTZYHPZIKSW-ADLZZSLISA-N |
| XLogP | 3.10 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|