C16H16O6 — CID 135249318
(6R,7R)-6-(3,4,5-trihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol (PubChem CID 135249318) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (6R,7R)-6-(3,4,5-trihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol.
| Compound Name | (6R,7R)-6-(3,4,5-trihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol |
|---|---|
| PubChem CID | 135249318 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (6R,7R)-6-(3,4,5-trihydroxyphenyl)-5,6,7,8-tetrahydronaphthalene-1,3,7-triol |
| SMILES | Oc1cc(O)c2c(c1)C[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C16H16O6/c17-9-1-7-2-10(13(19)6-11(7)12(18)5-9)8-3-14(20)16(22)15(21)4-8/h1,3-5,10,13,17-22H,2,6H2/t10-,13-/m1/s1 |
| InChIKey | BOMPCBQZQPYIIK-ZWNOBZJWSA-N |
| XLogP | 1.46 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|