C21H20O9 — CID 70546927
methyl 4-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-oxo-4H-chromen-7-yl]oxy]-3-oxobutanoate (PubChem CID 70546927) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is methyl 4-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-oxo-4H-chromen-7-yl]oxy]-3-oxobutanoate.
| Compound Name | methyl 4-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-oxo-4H-chromen-7-yl]oxy]-3-oxobutanoate |
|---|---|
| PubChem CID | 70546927 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | methyl 4-[[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3-oxo-4H-chromen-7-yl]oxy]-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)COc1cc(O)c2c(c1)OC(c1ccc(OC)c(O)c1)C(=O)C2 |
| InChI | InChI=1S/C21H20O9/c1-27-18-4-3-11(5-16(18)24)21-17(25)9-14-15(23)7-13(8-19(14)30-21)29-10-12(22)6-20(26)28-2/h3-5,7-8,21,23-24H,6,9-10H2,1-2H3 |
| InChIKey | VFIJMAZVSYQWJN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|