C20H22O8 — CID 68923901
2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-3-one (PubChem CID 68923901) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-3-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-3-one |
|---|---|
| PubChem CID | 68923901 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-3-one |
| SMILES | COc1ccc(C2Oc3c(c(O)c(OC)c(OC)c3OC)CC2=O)cc1OC |
| InChI | InChI=1S/C20H22O8/c1-23-13-7-6-10(8-14(13)24-2)16-12(21)9-11-15(22)18(25-3)20(27-5)19(26-4)17(11)28-16/h6-8,16,22H,9H2,1-5H3 |
| InChIKey | OCABACTXMAPWIF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |