C16H14O5 — CID 118870812
5,7-dihydroxy-8-methoxy-2-phenyl-4H-chromen-3-one (PubChem CID 118870812) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 5,7-dihydroxy-8-methoxy-2-phenyl-4H-chromen-3-one.
| Compound Name | 5,7-dihydroxy-8-methoxy-2-phenyl-4H-chromen-3-one |
|---|---|
| PubChem CID | 118870812 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5,7-dihydroxy-8-methoxy-2-phenyl-4H-chromen-3-one |
| SMILES | COc1c(O)cc(O)c2c1OC(c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C16H14O5/c1-20-16-13(19)8-11(17)10-7-12(18)14(21-15(10)16)9-5-3-2-4-6-9/h2-6,8,14,17,19H,7H2,1H3 |
| InChIKey | JOQGKBSUMOIJDZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |