C20H22O7 — CID 175541735
2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-4H-chromen-3-one (PubChem CID 175541735) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-4H-chromen-3-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-4H-chromen-3-one |
|---|---|
| PubChem CID | 175541735 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-4H-chromen-3-one |
| SMILES | COc1ccc(C2Oc3cc(OC)c(OC)c(OC)c3CC2=O)cc1OC |
| InChI | InChI=1S/C20H22O7/c1-22-14-7-6-11(8-16(14)23-2)18-13(21)9-12-15(27-18)10-17(24-3)20(26-5)19(12)25-4/h6-8,10,18H,9H2,1-5H3 |
| InChIKey | ZKAMCZOSMJVKDR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |