C26H25NO8 — CID 174648148
[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]-methylamino] 2-phenylbutanoate (PubChem CID 174648148) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is [[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]-methylamino] 2-phenylbutanoate.
| Compound Name | [[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]-methylamino] 2-phenylbutanoate |
|---|---|
| PubChem CID | 174648148 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]-methylamino] 2-phenylbutanoate |
| SMILES | CCC(C(=O)ON(C)C1C(=O)c2c(O)cc(O)cc2OC1c1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO8/c1-3-17(14-7-5-4-6-8-14)26(33)35-27(2)23-24(32)22-20(31)12-16(28)13-21(22)34-25(23)15-9-10-18(29)19(30)11-15/h4-13,17,23,25,28-31H,3H2,1-2H3 |
| InChIKey | YAIIZSZHFYPYCE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|