C18H16O9 — CID 100927739
(6R,6aS,12aR)-6,9,11,12a-tetrahydroxy-2,3-dimethoxy-6,6a-dihydrochromeno[3,4-b]chromen-12-one (PubChem CID 100927739) has the molecular formula C18H16O9 and a molecular weight of 376.32 g/mol. Its IUPAC name is (6R,6aS,12aR)-6,9,11,12a-tetrahydroxy-2,3-dimethoxy-6,6a-dihydrochromeno[3,4-b]chromen-12-one.
| Compound Name | (6R,6aS,12aR)-6,9,11,12a-tetrahydroxy-2,3-dimethoxy-6,6a-dihydrochromeno[3,4-b]chromen-12-one |
|---|---|
| PubChem CID | 100927739 |
| Molecular Formula | C18H16O9 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (6R,6aS,12aR)-6,9,11,12a-tetrahydroxy-2,3-dimethoxy-6,6a-dihydrochromeno[3,4-b]chromen-12-one |
| SMILES | COc1cc2c(cc1OC)[C@]1(O)C(=O)c3c(O)cc(O)cc3O[C@@H]1[C@H](O)O2 |
| InChI | InChI=1S/C18H16O9/c1-24-11-5-8-10(6-12(11)25-2)27-17(22)16-18(8,23)15(21)14-9(20)3-7(19)4-13(14)26-16/h3-6,16-17,19-20,22-23H,1-2H3/t16-,17-,18+/m1/s1 |
| InChIKey | PYIMOMJIHXEJKY-KURKYZTESA-N |
| XLogP | 0.66 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |