C17H14O8 — CID 102137967
2,4-dihydroxy-2-(4-hydroxy-3-methoxybenzoyl)-6-methoxy-1-benzofuran-3-one (PubChem CID 102137967) has the molecular formula C17H14O8 and a molecular weight of 346.29 g/mol. Its IUPAC name is 2,4-dihydroxy-2-(4-hydroxy-3-methoxybenzoyl)-6-methoxy-1-benzofuran-3-one.
| Compound Name | 2,4-dihydroxy-2-(4-hydroxy-3-methoxybenzoyl)-6-methoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 102137967 |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2,4-dihydroxy-2-(4-hydroxy-3-methoxybenzoyl)-6-methoxy-1-benzofuran-3-one |
| SMILES | COc1cc(O)c2c(c1)OC(O)(C(=O)c1ccc(O)c(OC)c1)C2=O |
| InChI | InChI=1S/C17H14O8/c1-23-9-6-11(19)14-13(7-9)25-17(22,16(14)21)15(20)8-3-4-10(18)12(5-8)24-2/h3-7,18-19,22H,1-2H3 |
| InChIKey | ZAHNUQKDCNOUEK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|