C18H18O9 — CID 154812475
3,3,5-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,7-dimethoxychromen-4-one (PubChem CID 154812475) has the molecular formula C18H18O9 and a molecular weight of 378.33 g/mol. Its IUPAC name is 3,3,5-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,7-dimethoxychromen-4-one.
| Compound Name | 3,3,5-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 154812475 |
| Molecular Formula | C18H18O9 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3,3,5-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,7-dimethoxychromen-4-one |
| SMILES | COc1cc(O)c2c(c1)OC(OC)(c1ccc(O)c(OC)c1)C(O)(O)C2=O |
| InChI | InChI=1S/C18H18O9/c1-24-10-7-12(20)15-14(8-10)27-18(26-3,17(22,23)16(15)21)9-4-5-11(19)13(6-9)25-2/h4-8,19-20,22-23H,1-3H3 |
| InChIKey | VVAQRJDTSNXXPY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|