C30H18O14 — CID 163004198
(1aS,7aS)-1a-(3,4-dihydroxyphenyl)-7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-4,6-dihydroxyoxireno[2,3-b]chromen-7-one (PubChem CID 163004198) has the molecular formula C30H18O14 and a molecular weight of 602.46 g/mol. Its IUPAC name is (1aS,7aS)-1a-(3,4-dihydroxyphenyl)-7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-4,6-dihydroxyoxireno[2,3-b]chromen-7-one.
| Compound Name | (1aS,7aS)-1a-(3,4-dihydroxyphenyl)-7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-4,6-dihydroxyoxireno[2,3-b]chromen-7-one |
|---|---|
| PubChem CID | 163004198 |
| Molecular Formula | C30H18O14 |
| Molecular Weight | 602.46 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | (1aS,7aS)-1a-(3,4-dihydroxyphenyl)-7a-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-4,6-dihydroxyoxireno[2,3-b]chromen-7-one |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@@]2(c3ccc(O)c(O)c3)O[C@@]12c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C30H18O14/c31-12-7-17(36)21-20(8-12)43-30(11-2-4-14(33)16(35)6-11)29(44-30,28(21)41)23-19(38)9-18(37)22-24(39)25(40)26(42-27(22)23)10-1-3-13(32)15(34)5-10/h1-9,31-38,40H/t29-,30-/m0/s1 |
| InChIKey | GDJLVXBHOZHHNY-KYJUHHDHSA-N |
| XLogP | 3.16 |
| TPSA | 251.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|