C15H9BrO7 — CID 56617277
8-bromo-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one (PubChem CID 56617277) has the molecular formula C15H9BrO7 and a molecular weight of 381.13 g/mol. Its IUPAC name is 8-bromo-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one.
| Compound Name | 8-bromo-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 56617277 |
| Molecular Formula | C15H9BrO7 |
| Molecular Weight | 381.13 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 8-bromo-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(Br)c(O)cc(O)c12 |
| InChI | InChI=1S/C15H9BrO7/c16-11-9(20)4-8(19)10-12(21)13(22)14(23-15(10)11)5-1-2-6(17)7(18)3-5/h1-4,17-20,22H |
| InChIKey | VVDGZNCCJOUXMD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.13 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|