C24H21NO7 — CID 118720185
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2-phenylethylamino)methyl]chromen-4-one (PubChem CID 118720185) has the molecular formula C24H21NO7 and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2-phenylethylamino)methyl]chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2-phenylethylamino)methyl]chromen-4-one |
|---|---|
| PubChem CID | 118720185 |
| Molecular Formula | C24H21NO7 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2-phenylethylamino)methyl]chromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(CNCCc3ccccc3)c(O)cc(O)c12 |
| InChI | InChI=1S/C24H21NO7/c26-16-7-6-14(10-18(16)28)23-22(31)21(30)20-19(29)11-17(27)15(24(20)32-23)12-25-9-8-13-4-2-1-3-5-13/h1-7,10-11,25-29,31H,8-9,12H2 |
| InChIKey | BQCFSEREEIJYBJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|