C25H20O10 — CID 71826999
methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-hydroxyphenyl)propanoate (PubChem CID 71826999) has the molecular formula C25H20O10 and a molecular weight of 480.43 g/mol. Its IUPAC name is methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 71826999 |
| Molecular Formula | C25H20O10 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)CC(c1ccc(O)cc1)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C25H20O10/c1-34-19(31)9-14(11-2-5-13(26)6-3-11)20-17(29)10-18(30)21-22(32)23(33)24(35-25(20)21)12-4-7-15(27)16(28)8-12/h2-8,10,14,26-30,33H,9H2,1H3 |
| InChIKey | GDOHSEKVIMUCKH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 177.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|