C24H19NO9 — CID 97488541
methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-pyridin-4-ylpropanoate (PubChem CID 97488541) has the molecular formula C24H19NO9 and a molecular weight of 465.41 g/mol. Its IUPAC name is methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-pyridin-4-ylpropanoate.
| Compound Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-pyridin-4-ylpropanoate |
|---|---|
| PubChem CID | 97488541 |
| Molecular Formula | C24H19NO9 |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-pyridin-4-ylpropanoate |
| SMILES | COC(=O)C[C@@H](c1ccncc1)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C24H19NO9/c1-33-18(30)9-13(11-4-6-25-7-5-11)19-16(28)10-17(29)20-21(31)22(32)23(34-24(19)20)12-2-3-14(26)15(27)8-12/h2-8,10,13,26-29,32H,9H2,1H3/t13-/m0/s1 |
| InChIKey | ZZSMYMPCTPYKQX-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|