C29H23NO11 — CID 98885073
methyl (3R)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate (PubChem CID 98885073) has the molecular formula C29H23NO11 and a molecular weight of 561.50 g/mol. Its IUPAC name is methyl (3R)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate.
| Compound Name | methyl (3R)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate |
|---|---|
| PubChem CID | 98885073 |
| Molecular Formula | C29H23NO11 |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | methyl (3R)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(6-methoxy-2-oxo-1H-quinolin-3-yl)propanoate |
| SMILES | COC(=O)C[C@@H](c1cc2cc(OC)ccc2[nH]c1=O)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C29H23NO11/c1-39-14-4-5-17-13(7-14)8-16(29(38)30-17)15(10-22(35)40-2)23-20(33)11-21(34)24-25(36)26(37)27(41-28(23)24)12-3-6-18(31)19(32)9-12/h3-9,11,15,31-34,37H,10H2,1-2H3,(H,30,38)/t15-/m0/s1 |
| InChIKey | GVEICTMRUVWSCF-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 199.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|