C23H18O10 — CID 71827367
methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(furan-2-yl)propanoate (PubChem CID 71827367) has the molecular formula C23H18O10 and a molecular weight of 454.39 g/mol. Its IUPAC name is methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(furan-2-yl)propanoate.
| Compound Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 71827367 |
| Molecular Formula | C23H18O10 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(furan-2-yl)propanoate |
| SMILES | COC(=O)CC(c1ccco1)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C23H18O10/c1-31-17(28)8-11(16-3-2-6-32-16)18-14(26)9-15(27)19-20(29)21(30)22(33-23(18)19)10-4-5-12(24)13(25)7-10/h2-7,9,11,24-27,30H,8H2,1H3 |
| InChIKey | KDSKOIHENZZWTE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 170.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|