C27H24O11 — CID 98885334
methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[3-(hydroxymethyl)-4-methoxyphenyl]propanoate (PubChem CID 98885334) has the molecular formula C27H24O11 and a molecular weight of 524.48 g/mol. Its IUPAC name is methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[3-(hydroxymethyl)-4-methoxyphenyl]propanoate.
| Compound Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[3-(hydroxymethyl)-4-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 98885334 |
| Molecular Formula | C27H24O11 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[3-(hydroxymethyl)-4-methoxyphenyl]propanoate |
| SMILES | COC(=O)C[C@@H](c1ccc(OC)c(CO)c1)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C27H24O11/c1-36-20-6-4-12(7-14(20)11-28)15(9-21(33)37-2)22-18(31)10-19(32)23-24(34)25(35)26(38-27(22)23)13-3-5-16(29)17(30)8-13/h3-8,10,15,28-32,35H,9,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | YDHKSHWFMKBTTK-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 187.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|