C29H26O10 — CID 98885000
methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate (PubChem CID 98885000) has the molecular formula C29H26O10 and a molecular weight of 534.52 g/mol. Its IUPAC name is methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate.
| Compound Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 98885000 |
| Molecular Formula | C29H26O10 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-[4-(2-methylprop-2-enoxy)phenyl]propanoate |
| SMILES | C=C(C)COc1ccc([C@H](CC(=O)OC)c2c(O)cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)cc1 |
| InChI | InChI=1S/C29H26O10/c1-14(2)13-38-17-7-4-15(5-8-17)18(11-23(34)37-3)24-21(32)12-22(33)25-26(35)27(36)28(39-29(24)25)16-6-9-19(30)20(31)10-16/h4-10,12,18,30-33,36H,1,11,13H2,2-3H3/t18-/m0/s1 |
| InChIKey | LOBYOIOQWCHLJH-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|