C26H22O11 — CID 71826836
methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(3-hydroxy-4-methoxyphenyl)propanoate (PubChem CID 71826836) has the molecular formula C26H22O11 and a molecular weight of 510.45 g/mol. Its IUPAC name is methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(3-hydroxy-4-methoxyphenyl)propanoate.
| Compound Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(3-hydroxy-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 71826836 |
| Molecular Formula | C26H22O11 |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(3-hydroxy-4-methoxyphenyl)propanoate |
| SMILES | COC(=O)CC(c1ccc(OC)c(O)c1)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C26H22O11/c1-35-19-6-4-11(7-16(19)29)13(9-20(32)36-2)21-17(30)10-18(31)22-23(33)24(34)25(37-26(21)22)12-3-5-14(27)15(28)8-12/h3-8,10,13,27-31,34H,9H2,1-2H3 |
| InChIKey | BTDTVTLQEHMGRN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 187.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|