C28H21NO9 — CID 75492497
methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-quinolin-6-ylpropanoate (PubChem CID 75492497) has the molecular formula C28H21NO9 and a molecular weight of 515.47 g/mol. Its IUPAC name is methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-quinolin-6-ylpropanoate.
| Compound Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-quinolin-6-ylpropanoate |
|---|---|
| PubChem CID | 75492497 |
| Molecular Formula | C28H21NO9 |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | methyl 3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-quinolin-6-ylpropanoate |
| SMILES | COC(=O)CC(c1ccc2ncccc2c1)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C28H21NO9/c1-37-22(34)11-16(13-4-6-17-14(9-13)3-2-8-29-17)23-20(32)12-21(33)24-25(35)26(36)27(38-28(23)24)15-5-7-18(30)19(31)10-15/h2-10,12,16,30-33,36H,11H2,1H3 |
| InChIKey | BEFSJYDSBLFNQS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|