C25H19FO9 — CID 97488886
methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-fluorophenyl)propanoate (PubChem CID 97488886) has the molecular formula C25H19FO9 and a molecular weight of 482.42 g/mol. Its IUPAC name is methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-fluorophenyl)propanoate.
| Compound Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 97488886 |
| Molecular Formula | C25H19FO9 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | methyl (3S)-3-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxochromen-8-yl]-3-(4-fluorophenyl)propanoate |
| SMILES | COC(=O)C[C@@H](c1ccc(F)cc1)c1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C25H19FO9/c1-34-19(31)9-14(11-2-5-13(26)6-3-11)20-17(29)10-18(30)21-22(32)23(33)24(35-25(20)21)12-4-7-15(27)16(28)8-12/h2-8,10,14,27-30,33H,9H2,1H3/t14-/m0/s1 |
| InChIKey | KTQUUMDHURNNDU-AWEZNQCLSA-N |
| XLogP | 3.82 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|