C22H15BrO7 — CID 174676079
7-[(2-bromophenoxy)methyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one (PubChem CID 174676079) has the molecular formula C22H15BrO7 and a molecular weight of 471.26 g/mol. Its IUPAC name is 7-[(2-bromophenoxy)methyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one.
| Compound Name | 7-[(2-bromophenoxy)methyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 174676079 |
| Molecular Formula | C22H15BrO7 |
| Molecular Weight | 471.26 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 7-[(2-bromophenoxy)methyl]-2-(3,4-dihydroxyphenyl)-3,5-dihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(COc3ccccc3Br)cc(O)c12 |
| InChI | InChI=1S/C22H15BrO7/c23-13-3-1-2-4-17(13)29-10-11-7-16(26)19-18(8-11)30-22(21(28)20(19)27)12-5-6-14(24)15(25)9-12/h1-9,24-26,28H,10H2 |
| InChIKey | IZCSPVWWDDNOGL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|