C22H15NO9 — CID 174688090
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2-nitrophenoxy)methyl]chromen-4-one (PubChem CID 174688090) has the molecular formula C22H15NO9 and a molecular weight of 437.36 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2-nitrophenoxy)methyl]chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2-nitrophenoxy)methyl]chromen-4-one |
|---|---|
| PubChem CID | 174688090 |
| Molecular Formula | C22H15NO9 |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2-nitrophenoxy)methyl]chromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(COc3ccccc3[N+](=O)[O-])cc(O)c12 |
| InChI | InChI=1S/C22H15NO9/c24-14-6-5-12(9-15(14)25)22-21(28)20(27)19-16(26)7-11(8-18(19)32-22)10-31-17-4-2-1-3-13(17)23(29)30/h1-9,24-26,28H,10H2 |
| InChIKey | DZAGZJRCPKGCKY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 163.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|