C18H14O9 — CID 44592398
methyl 2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxyacetate (PubChem CID 44592398) has the molecular formula C18H14O9 and a molecular weight of 374.30 g/mol. Its IUPAC name is methyl 2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxyacetate.
| Compound Name | methyl 2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 44592398 |
| Molecular Formula | C18H14O9 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | methyl 2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxyacetate |
| SMILES | COC(=O)COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C18H14O9/c1-25-14(22)7-26-9-5-12(21)15-13(6-9)27-18(17(24)16(15)23)8-2-3-10(19)11(20)4-8/h2-6,19-21,24H,7H2,1H3 |
| InChIKey | QKJFELGSRIDINW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|