C21H20O11 — CID 162983395
2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2R,3R,4R,5R,6R)-3,5,6-trihydroxy-4-methyloxan-2-yl]oxychromen-4-one (PubChem CID 162983395) has the molecular formula C21H20O11 and a molecular weight of 448.38 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2R,3R,4R,5R,6R)-3,5,6-trihydroxy-4-methyloxan-2-yl]oxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2R,3R,4R,5R,6R)-3,5,6-trihydroxy-4-methyloxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 162983395 |
| Molecular Formula | C21H20O11 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2R,3R,4R,5R,6R)-3,5,6-trihydroxy-4-methyloxan-2-yl]oxychromen-4-one |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)O[C@@H](Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c2)[C@@H]1O |
| InChI | InChI=1S/C21H20O11/c1-7-15(25)20(29)32-21(16(7)26)30-9-5-12(24)14-13(6-9)31-19(18(28)17(14)27)8-2-3-10(22)11(23)4-8/h2-7,15-16,20-26,28-29H,1H3/t7-,15-,16-,20-,21-/m1/s1 |
| InChIKey | KWYHWBQEIQXCFS-QFMNYRLKSA-N |
| XLogP | 0.69 |
| TPSA | 190.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|