C21H16O12 — CID 162843903
2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 162843903) has the molecular formula C21H16O12 and a molecular weight of 460.35 g/mol. Its IUPAC name is 2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 162843903 |
| Molecular Formula | C21H16O12 |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxochromen-7-yl]oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | O=C(O)C1=CC(O)C(O)C(Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc3c2)O1 |
| InChI | InChI=1S/C21H16O12/c22-9-2-1-7(3-10(9)23)19-18(28)17(27)15-11(24)4-8(5-13(15)32-19)31-21-16(26)12(25)6-14(33-21)20(29)30/h1-6,12,16,21-26,28H,(H,29,30) |
| InChIKey | PVARKDPFQOSDCZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 207.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|