C30H18O13 — CID 101175619
1a-(3,4-dihydroxyphenyl)-4,6-dihydroxy-7a-[2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]oxireno[2,3-b]chromen-7-one (PubChem CID 101175619) has the molecular formula C30H18O13 and a molecular weight of 586.46 g/mol. Its IUPAC name is 1a-(3,4-dihydroxyphenyl)-4,6-dihydroxy-7a-[2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]oxireno[2,3-b]chromen-7-one.
| Compound Name | 1a-(3,4-dihydroxyphenyl)-4,6-dihydroxy-7a-[2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]oxireno[2,3-b]chromen-7-one |
|---|---|
| PubChem CID | 101175619 |
| Molecular Formula | C30H18O13 |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | 1a-(3,4-dihydroxyphenyl)-4,6-dihydroxy-7a-[2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]oxireno[2,3-b]chromen-7-one |
| SMILES | O=C1c2c(O)cc(O)cc2OC2(c3ccc(O)c(O)c3)OC12c1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1O |
| InChI | InChI=1S/C30H18O13/c31-13-7-19(36)23-21(9-13)41-27(26(39)25(23)38)11-1-3-15(17(34)5-11)29-28(40)24-20(37)8-14(32)10-22(24)42-30(29,43-29)12-2-4-16(33)18(35)6-12/h1-10,31-37,39H |
| InChIKey | XNJIIKGOQZEPDP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 230.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|