C30H26O13 — CID 124526418
(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-3,4-dihydrochromene-3,4,5,7-tetrol (PubChem CID 124526418) has the molecular formula C30H26O13 and a molecular weight of 594.53 g/mol. Its IUPAC name is (2R,3S,4S)-2-(3,4-dihydroxyphenyl)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-3,4-dihydrochromene-3,4,5,7-tetrol.
| Compound Name | (2R,3S,4S)-2-(3,4-dihydroxyphenyl)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-3,4-dihydrochromene-3,4,5,7-tetrol |
|---|---|
| PubChem CID | 124526418 |
| Molecular Formula | C30H26O13 |
| Molecular Weight | 594.53 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | (2R,3S,4S)-2-(3,4-dihydroxyphenyl)-2-[[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-3,4-dihydrochromene-3,4,5,7-tetrol |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O[C@]1(c3ccc(O)c(O)c3)Oc3cc(O)cc(O)c3[C@H](O)[C@@H]1O)C2 |
| InChI | InChI=1S/C30H26O13/c31-14-7-19(35)16-11-25(28(41-23(16)9-14)12-1-3-17(33)20(36)5-12)43-30(13-2-4-18(34)21(37)6-13)29(40)27(39)26-22(38)8-15(32)10-24(26)42-30/h1-10,25,27-29,31-40H,11H2/t25-,27+,28-,29+,30+/m1/s1 |
| InChIKey | HGVVOUNEGQIPMS-JURZQKOZSA-N |
| XLogP | 2.73 |
| TPSA | 229.99 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|