C16H14O7 — CID 67149819
2-[(3,4-dihydroxyphenyl)methyl]-3,5,7-trihydroxy-2,3-dihydrochromen-4-one (PubChem CID 67149819) has the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methyl]-3,5,7-trihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methyl]-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 67149819 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methyl]-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2c(O)cc(O)cc2OC(Cc2ccc(O)c(O)c2)C1O |
| InChI | InChI=1S/C16H14O7/c17-8-5-11(20)14-12(6-8)23-13(15(21)16(14)22)4-7-1-2-9(18)10(19)3-7/h1-3,5-6,13,15,17-21H,4H2 |
| InChIKey | BJJAXTIWTVZGAW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|