C18H14O7 — CID 78319183
6,10,11-trihydroxy-1,1-dimethyl-2H-pyrano[2,3-c]xanthene-3,7-dione (PubChem CID 78319183) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is 6,10,11-trihydroxy-1,1-dimethyl-2H-pyrano[2,3-c]xanthene-3,7-dione.
| Compound Name | 6,10,11-trihydroxy-1,1-dimethyl-2H-pyrano[2,3-c]xanthene-3,7-dione |
|---|---|
| PubChem CID | 78319183 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 6,10,11-trihydroxy-1,1-dimethyl-2H-pyrano[2,3-c]xanthene-3,7-dione |
| SMILES | CC1(C)CC(=O)Oc2cc(O)c3c(=O)c4ccc(O)c(O)c4oc3c21 |
| InChI | InChI=1S/C18H14O7/c1-18(2)6-11(21)24-10-5-9(20)12-14(22)7-3-4-8(19)15(23)16(7)25-17(12)13(10)18/h3-5,19-20,23H,6H2,1-2H3 |
| InChIKey | CXLICXCFFUXQGJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|