C16H12O5 — CID 5400219
7,8-dihydroxy-2-methyl-3-phenoxychromen-4-one (PubChem CID 5400219) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 7,8-dihydroxy-2-methyl-3-phenoxychromen-4-one.
| Compound Name | 7,8-dihydroxy-2-methyl-3-phenoxychromen-4-one |
|---|---|
| PubChem CID | 5400219 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 7,8-dihydroxy-2-methyl-3-phenoxychromen-4-one |
| SMILES | Cc1oc2c(O)c(O)ccc2c(=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C16H12O5/c1-9-15(21-10-5-3-2-4-6-10)13(18)11-7-8-12(17)14(19)16(11)20-9/h2-8,17,19H,1H3 |
| InChIKey | WOQXPLPDTBCBCT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|