C25H30NO4+ — CID 7540382
8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxy-2-methylchromen-4-one (PubChem CID 7540382) has the molecular formula C25H30NO4+ and a molecular weight of 408.52 g/mol. Its IUPAC name is 8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxy-2-methylchromen-4-one.
| Compound Name | 8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxy-2-methylchromen-4-one |
|---|---|
| PubChem CID | 7540382 |
| Molecular Formula | C25H30NO4+ |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxy-2-methylchromen-4-one |
| SMILES | Cc1cc(C)cc(Oc2c(C)oc3c(C[NH+]4CCCCCC4)c(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C25H29NO4/c1-16-12-17(2)14-19(13-16)30-24-18(3)29-25-20(23(24)28)8-9-22(27)21(25)15-26-10-6-4-5-7-11-26/h8-9,12-14,27H,4-7,10-11,15H2,1-3H3/p+1 |
| InChIKey | GHCQANLUGHWYGZ-UHFFFAOYSA-O |
| XLogP | 4.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|