C24H25F3NO4+ — CID 6972968
7-hydroxy-3-(3-methylphenoxy)-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one (PubChem CID 6972968) has the molecular formula C24H25F3NO4+ and a molecular weight of 448.46 g/mol. Its IUPAC name is 7-hydroxy-3-(3-methylphenoxy)-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 7-hydroxy-3-(3-methylphenoxy)-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 6972968 |
| Molecular Formula | C24H25F3NO4+ |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 7-hydroxy-3-(3-methylphenoxy)-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
| SMILES | Cc1cccc(Oc2c(C(F)(F)F)oc3c(C[NH+]4CCCC[C@@H]4C)c(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C24H24F3NO4/c1-14-6-5-8-16(12-14)31-22-20(30)17-9-10-19(29)18(13-28-11-4-3-7-15(28)2)21(17)32-23(22)24(25,26)27/h5-6,8-10,12,15,29H,3-4,7,11,13H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | FGHLSHCVMZJNMM-HNNXBMFYSA-O |
| XLogP | 4.58 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|