C24H24ClF3NO3+ — CID 7897488
3-(2-chlorophenyl)-8-[[(2S)-2-ethylpiperidin-1-ium-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 7897488) has the molecular formula C24H24ClF3NO3+ and a molecular weight of 466.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-8-[[(2S)-2-ethylpiperidin-1-ium-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2-chlorophenyl)-8-[[(2S)-2-ethylpiperidin-1-ium-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 7897488 |
| Molecular Formula | C24H24ClF3NO3+ |
| Molecular Weight | 466.91 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-(2-chlorophenyl)-8-[[(2S)-2-ethylpiperidin-1-ium-1-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | CC[C@H]1CCCC[NH+]1Cc1c(O)ccc2c(=O)c(-c3ccccc3Cl)c(C(F)(F)F)oc12 |
| InChI | InChI=1S/C24H23ClF3NO3/c1-2-14-7-5-6-12-29(14)13-17-19(30)11-10-16-21(31)20(15-8-3-4-9-18(15)25)23(24(26,27)28)32-22(16)17/h3-4,8-11,14,30H,2,5-7,12-13H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | DQHDGEURVWNDAG-AWEZNQCLSA-O |
| XLogP | 5.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|