C22H23F3N2O3+2 — CID 7126048
7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-3-phenyl-2-(trifluoromethyl)chromen-4-one (PubChem CID 7126048) has the molecular formula C22H23F3N2O3+2 and a molecular weight of 420.43 g/mol. Its IUPAC name is 7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-3-phenyl-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-3-phenyl-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 7126048 |
| Molecular Formula | C22H23F3N2O3+2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 7-hydroxy-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-3-phenyl-2-(trifluoromethyl)chromen-4-one |
| SMILES | C[NH+]1CC[NH+](Cc2c(O)ccc3c(=O)c(-c4ccccc4)c(C(F)(F)F)oc23)CC1 |
| InChI | InChI=1S/C22H21F3N2O3/c1-26-9-11-27(12-10-26)13-16-17(28)8-7-15-19(29)18(14-5-3-2-4-6-14)21(22(23,24)25)30-20(15)16/h2-8,28H,9-13H2,1H3/p+2 |
| InChIKey | WLBNKUZVUKSAHV-UHFFFAOYSA-P |
| XLogP | 1.10 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|