C21H17ClF3NO3 — CID 5450121
3-(3-chlorophenyl)-7-hydroxy-8-(pyrrolidin-1-ylmethyl)-2-(trifluoromethyl)chromen-4-one (PubChem CID 5450121) has the molecular formula C21H17ClF3NO3 and a molecular weight of 423.82 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-7-hydroxy-8-(pyrrolidin-1-ylmethyl)-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(3-chlorophenyl)-7-hydroxy-8-(pyrrolidin-1-ylmethyl)-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 5450121 |
| Molecular Formula | C21H17ClF3NO3 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 3-(3-chlorophenyl)-7-hydroxy-8-(pyrrolidin-1-ylmethyl)-2-(trifluoromethyl)chromen-4-one |
| SMILES | O=c1c(-c2cccc(Cl)c2)c(C(F)(F)F)oc2c(CN3CCCC3)c(O)ccc12 |
| InChI | InChI=1S/C21H17ClF3NO3/c22-13-5-3-4-12(10-13)17-18(28)14-6-7-16(27)15(11-26-8-1-2-9-26)19(14)29-20(17)21(23,24)25/h3-7,10,27H,1-2,8-9,11H2 |
| InChIKey | BYKFHSCEKSFEKX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|