C25H27ClF3NO3 — CID 51064376
3-(3-chlorophenyl)-8-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one;methane (PubChem CID 51064376) has the molecular formula C25H27ClF3NO3 and a molecular weight of 481.94 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-8-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one;methane.
| Compound Name | 3-(3-chlorophenyl)-8-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one;methane |
|---|---|
| PubChem CID | 51064376 |
| Molecular Formula | C25H27ClF3NO3 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 3-(3-chlorophenyl)-8-[(2-ethylpiperidin-1-yl)methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one;methane |
| SMILES | C.CCC1CCCCN1Cc1c(O)ccc2c(=O)c(-c3cccc(Cl)c3)c(C(F)(F)F)oc12 |
| InChI | InChI=1S/C24H23ClF3NO3.CH4/c1-2-16-8-3-4-11-29(16)13-18-19(30)10-9-17-21(31)20(14-6-5-7-15(25)12-14)23(24(26,27)28)32-22(17)18;/h5-7,9-10,12,16,30H,2-4,8,11,13H2,1H3;1H4 |
| InChIKey | GWRZTGNCFCDBTJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|