C22H25NO3 — CID 6958413
4-[[(2S)-2-ethylpiperidin-1-yl]methyl]-3-hydroxy-1-methylbenzo[c]chromen-6-one (PubChem CID 6958413) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[[(2S)-2-ethylpiperidin-1-yl]methyl]-3-hydroxy-1-methylbenzo[c]chromen-6-one.
| Compound Name | 4-[[(2S)-2-ethylpiperidin-1-yl]methyl]-3-hydroxy-1-methylbenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 6958413 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-[[(2S)-2-ethylpiperidin-1-yl]methyl]-3-hydroxy-1-methylbenzo[c]chromen-6-one |
| SMILES | CC[C@H]1CCCCN1Cc1c(O)cc(C)c2c1oc(=O)c1ccccc12 |
| InChI | InChI=1S/C22H25NO3/c1-3-15-8-6-7-11-23(15)13-18-19(24)12-14(2)20-16-9-4-5-10-17(16)22(25)26-21(18)20/h4-5,9-10,12,15,24H,3,6-8,11,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | UKJAVIXLTRJIIJ-HNNXBMFYSA-N |
| XLogP | 4.72 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|