C14H19F2N — CID 870763
(2R)-1-[(2,6-difluorophenyl)methyl]-2-ethylpiperidine (PubChem CID 870763) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is (2R)-1-[(2,6-difluorophenyl)methyl]-2-ethylpiperidine.
| Compound Name | (2R)-1-[(2,6-difluorophenyl)methyl]-2-ethylpiperidine |
|---|---|
| PubChem CID | 870763 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2R)-1-[(2,6-difluorophenyl)methyl]-2-ethylpiperidine |
| SMILES | CC[C@@H]1CCCCN1Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2N/c1-2-11-6-3-4-9-17(11)10-12-13(15)7-5-8-14(12)16/h5,7-8,11H,2-4,6,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | HWIGOOOMPYTLQZ-LLVKDONJSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |