C14H20FN — CID 11401773
2-ethyl-1-[(3-fluoro-2-methylphenyl)methyl]pyrrolidine (PubChem CID 11401773) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-ethyl-1-[(3-fluoro-2-methylphenyl)methyl]pyrrolidine.
| Compound Name | 2-ethyl-1-[(3-fluoro-2-methylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 11401773 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-ethyl-1-[(3-fluoro-2-methylphenyl)methyl]pyrrolidine |
| SMILES | CCC1CCCN1Cc1cccc(F)c1C |
| InChI | InChI=1S/C14H20FN/c1-3-13-7-5-9-16(13)10-12-6-4-8-14(15)11(12)2/h4,6,8,13H,3,5,7,9-10H2,1-2H3 |
| InChIKey | RHBIEKCPQOFVOZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |