C14H19F2NO — CID 114933196
[1-[(2,6-difluorophenyl)methyl]azepan-2-yl]methanol (PubChem CID 114933196) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is [1-[(2,6-difluorophenyl)methyl]azepan-2-yl]methanol.
| Compound Name | [1-[(2,6-difluorophenyl)methyl]azepan-2-yl]methanol |
|---|---|
| PubChem CID | 114933196 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [1-[(2,6-difluorophenyl)methyl]azepan-2-yl]methanol |
| SMILES | OCC1CCCCCN1Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO/c15-13-6-4-7-14(16)12(13)9-17-8-3-1-2-5-11(17)10-18/h4,6-7,11,18H,1-3,5,8-10H2 |
| InChIKey | ZSJNQPXWGAGZJL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |