C15H21FN2OS — CID 107115714
2-fluoro-3-[[2-(hydroxymethyl)azepan-1-yl]methyl]benzenecarbothioamide (PubChem CID 107115714) has the molecular formula C15H21FN2OS and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-fluoro-3-[[2-(hydroxymethyl)azepan-1-yl]methyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-3-[[2-(hydroxymethyl)azepan-1-yl]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107115714 |
| Molecular Formula | C15H21FN2OS |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-fluoro-3-[[2-(hydroxymethyl)azepan-1-yl]methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CN2CCCCCC2CO)c1F |
| InChI | InChI=1S/C15H21FN2OS/c16-14-11(5-4-7-13(14)15(17)20)9-18-8-3-1-2-6-12(18)10-19/h4-5,7,12,19H,1-3,6,8-10H2,(H2,17,20) |
| InChIKey | LELZSCTXONWKCU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|