C29H27F3N2O5 — CID 95399182
3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one (PubChem CID 95399182) has the molecular formula C29H27F3N2O5 and a molecular weight of 540.54 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 95399182 |
| Molecular Formula | C29H27F3N2O5 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
| SMILES | COc1ccc(-c2c(C(F)(F)F)oc3c(CN4CCCC[C@H]4c4cccnc4)c(O)ccc3c2=O)cc1OC |
| InChI | InChI=1S/C29H27F3N2O5/c1-37-23-11-8-17(14-24(23)38-2)25-26(36)19-9-10-22(35)20(27(19)39-28(25)29(30,31)32)16-34-13-4-3-7-21(34)18-6-5-12-33-15-18/h5-6,8-12,14-15,21,35H,3-4,7,13,16H2,1-2H3/t21-/m0/s1 |
| InChIKey | CBTFZYWVFGIFHP-NRFANRHFSA-N |
| XLogP | 6.32 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|