C25H23N3O3 — CID 136887035
7-hydroxy-3-pyridin-2-yl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one (PubChem CID 136887035) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 7-hydroxy-3-pyridin-2-yl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one.
| Compound Name | 7-hydroxy-3-pyridin-2-yl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 136887035 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 7-hydroxy-3-pyridin-2-yl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one |
| SMILES | O=c1oc2c(CN3CCCC[C@H]3c3cccnc3)c(O)ccc2cc1-c1ccccn1 |
| InChI | InChI=1S/C25H23N3O3/c29-23-10-9-17-14-19(21-7-1-3-12-27-21)25(30)31-24(17)20(23)16-28-13-4-2-8-22(28)18-6-5-11-26-15-18/h1,3,5-7,9-12,14-15,22,29H,2,4,8,13,16H2/t22-/m0/s1 |
| InChIKey | XDFBAZNXUXBIEN-QFIPXVFZSA-N |
| XLogP | 4.68 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|