C27H26N2O4 — CID 39733932
(2Z)-6-hydroxy-2-[(4-methoxyphenyl)methylidene]-7-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1-benzofuran-3-one (PubChem CID 39733932) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is (2Z)-6-hydroxy-2-[(4-methoxyphenyl)methylidene]-7-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-hydroxy-2-[(4-methoxyphenyl)methylidene]-7-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 39733932 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2Z)-6-hydroxy-2-[(4-methoxyphenyl)methylidene]-7-[[(2R)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1-benzofuran-3-one |
| SMILES | COc1ccc(/C=C2\Oc3c(ccc(O)c3CN3CCCC[C@@H]3c3cccnc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-32-20-9-7-18(8-10-20)15-25-26(31)21-11-12-24(30)22(27(21)33-25)17-29-14-3-2-6-23(29)19-5-4-13-28-16-19/h4-5,7-13,15-16,23,30H,2-3,6,14,17H2,1H3/b25-15-/t23-/m1/s1 |
| InChIKey | NSPKOYAWBNWQTQ-UELZEPHDSA-N |
| XLogP | 5.14 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|