C26H24N2O3 — CID 29148177
7-hydroxy-3-phenyl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one (PubChem CID 29148177) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 7-hydroxy-3-phenyl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one.
| Compound Name | 7-hydroxy-3-phenyl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 29148177 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 7-hydroxy-3-phenyl-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one |
| SMILES | O=c1c(-c2ccccc2)coc2c(CN3CCCC[C@H]3c3cccnc3)c(O)ccc12 |
| InChI | InChI=1S/C26H24N2O3/c29-24-12-11-20-25(30)22(18-7-2-1-3-8-18)17-31-26(20)21(24)16-28-14-5-4-10-23(28)19-9-6-13-27-15-19/h1-3,6-9,11-13,15,17,23,29H,4-5,10,14,16H2/t23-/m0/s1 |
| InChIKey | NSGCFKWFBQELNH-QHCPKHFHSA-N |
| XLogP | 5.29 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|